C22H35N3O2 — CID 133117439
(1R,5S)-6-(2-methoxyethyl)-3-[1-(4-methoxyphenyl)piperidin-4-yl]-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 133117439) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (1R,5S)-6-(2-methoxyethyl)-3-[1-(4-methoxyphenyl)piperidin-4-yl]-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (1R,5S)-6-(2-methoxyethyl)-3-[1-(4-methoxyphenyl)piperidin-4-yl]-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 133117439 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (1R,5S)-6-(2-methoxyethyl)-3-[1-(4-methoxyphenyl)piperidin-4-yl]-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | COCCN1C[C@@H]2CC[C@H]1CN(C1CCN(c3ccc(OC)cc3)CC1)C2 |
| InChI | InChI=1S/C22H35N3O2/c1-26-14-13-24-15-18-3-4-21(24)17-25(16-18)20-9-11-23(12-10-20)19-5-7-22(27-2)8-6-19/h5-8,18,20-21H,3-4,9-17H2,1-2H3/t18-,21-/m0/s1 |
| InChIKey | OIXPAHFANYXUNU-RXVVDRJESA-N |
| XLogP | 2.71 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|