C22H35N3O2 — CID 155917775
(4S,9aR)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 155917775) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (4S,9aR)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 155917775 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (4S,9aR)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | CCC[C@H]1COC[C@H]2CN(C3CCN(c4ccc(OC)cc4)CC3)CCN12 |
| InChI | InChI=1S/C22H35N3O2/c1-3-4-20-16-27-17-21-15-24(13-14-25(20)21)19-9-11-23(12-10-19)18-5-7-22(26-2)8-6-18/h5-8,19-21H,3-4,9-17H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | RMZKSYVHNGEEQF-LEWJYISDSA-N |
| XLogP | 2.85 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|