C18H25N3O2 — CID 154567359
(3aS,6aS)-5-[1-(4-methoxyphenyl)piperidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 154567359) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (3aS,6aS)-5-[1-(4-methoxyphenyl)piperidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-[1-(4-methoxyphenyl)piperidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 154567359 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (3aS,6aS)-5-[1-(4-methoxyphenyl)piperidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | COc1ccc(N2CCC(N3C[C@@H]4CC(=O)N[C@@H]4C3)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-23-16-4-2-14(3-5-16)20-8-6-15(7-9-20)21-11-13-10-18(22)19-17(13)12-21/h2-5,13,15,17H,6-12H2,1H3,(H,19,22)/t13-,17+/m0/s1 |
| InChIKey | RXRSNHABIAISDM-SUMWQHHRSA-N |
| XLogP | 1.48 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|