C21H29N3O4 — CID 97193596
(4S)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylic acid (PubChem CID 97193596) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is (4S)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylic acid.
| Compound Name | (4S)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylic acid |
|---|---|
| PubChem CID | 97193596 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (4S)-8-[1-(4-methoxyphenyl)piperidin-4-yl]-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylic acid |
| SMILES | COc1ccc(N2CCC(N3CCC4(CC3)NC(=O)C[C@@H]4C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-28-17-4-2-15(3-5-17)23-10-6-16(7-11-23)24-12-8-21(9-13-24)18(20(26)27)14-19(25)22-21/h2-5,16,18H,6-14H2,1H3,(H,22,25)(H,26,27)/t18-/m1/s1 |
| InChIKey | QXYHJHMBZSUKAU-GOSISDBHSA-N |
| XLogP | 1.72 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|