C20H31N3O2S — CID 135109898
[4-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 135109898) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is [4-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 135109898 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [4-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CN1CCC[C@]2(CO)CCN(C3CCN(C(=O)c4cccs4)CC3)C[C@@H]12 |
| InChI | InChI=1S/C20H31N3O2S/c1-21-9-3-7-20(15-24)8-12-23(14-18(20)21)16-5-10-22(11-6-16)19(25)17-4-2-13-26-17/h2,4,13,16,18,24H,3,5-12,14-15H2,1H3/t18-,20-/m1/s1 |
| InChIKey | VQELZOHDWQNYHE-UYAOXDASSA-N |
| XLogP | 2.13 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |