C14H22N2O3S2 — CID 135103421
[(4aS,8aS)-1-methyl-7-thiophen-2-ylsulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135103421) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-thiophen-2-ylsulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-thiophen-2-ylsulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135103421 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-thiophen-2-ylsulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CN1CCC[C@]2(CO)CCN(S(=O)(=O)c3cccs3)C[C@@H]12 |
| InChI | InChI=1S/C14H22N2O3S2/c1-15-7-3-5-14(11-17)6-8-16(10-12(14)15)21(18,19)13-4-2-9-20-13/h2,4,9,12,17H,3,5-8,10-11H2,1H3/t12-,14-/m1/s1 |
| InChIKey | UMMGLYBIMGGFFH-TZMCWYRMSA-N |
| XLogP | 1.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |