C18H24ClFN2O2 — CID 135117870
1-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(2-chloro-4-fluorophenyl)ethanone (PubChem CID 135117870) has the molecular formula C18H24ClFN2O2 and a molecular weight of 354.85 g/mol. Its IUPAC name is 1-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(2-chloro-4-fluorophenyl)ethanone.
| Compound Name | 1-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(2-chloro-4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 135117870 |
| Molecular Formula | C18H24ClFN2O2 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(2-chloro-4-fluorophenyl)ethanone |
| SMILES | CN1CCC[C@]2(CO)CCN(C(=O)Cc3ccc(F)cc3Cl)C[C@@H]12 |
| InChI | InChI=1S/C18H24ClFN2O2/c1-21-7-2-5-18(12-23)6-8-22(11-16(18)21)17(24)9-13-3-4-14(20)10-15(13)19/h3-4,10,16,23H,2,5-9,11-12H2,1H3/t16-,18-/m1/s1 |
| InChIKey | KTFWFYGZDRVNLD-SJLPKXTDSA-N |
| XLogP | 2.33 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |