C17H25FN2O3S — CID 135095158
[(4aS,8aS)-7-(5-fluoro-2-methylphenyl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135095158) has the molecular formula C17H25FN2O3S and a molecular weight of 356.46 g/mol. Its IUPAC name is [(4aS,8aS)-7-(5-fluoro-2-methylphenyl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-7-(5-fluoro-2-methylphenyl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135095158 |
| Molecular Formula | C17H25FN2O3S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(4aS,8aS)-7-(5-fluoro-2-methylphenyl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CC[C@@]2(CO)CCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C17H25FN2O3S/c1-13-4-5-14(18)10-15(13)24(22,23)20-9-7-17(12-21)6-3-8-19(2)16(17)11-20/h4-5,10,16,21H,3,6-9,11-12H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | JYFBDZVRJPQFKK-IAGOWNOFSA-N |
| XLogP | 1.60 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |