C21H26FNO4S — CID 42303614
[1-(5-fluoro-2-methylphenyl)sulfonyl-4-(2-phenoxyethyl)piperidin-4-yl]methanol (PubChem CID 42303614) has the molecular formula C21H26FNO4S and a molecular weight of 407.51 g/mol. Its IUPAC name is [1-(5-fluoro-2-methylphenyl)sulfonyl-4-(2-phenoxyethyl)piperidin-4-yl]methanol.
| Compound Name | [1-(5-fluoro-2-methylphenyl)sulfonyl-4-(2-phenoxyethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 42303614 |
| Molecular Formula | C21H26FNO4S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [1-(5-fluoro-2-methylphenyl)sulfonyl-4-(2-phenoxyethyl)piperidin-4-yl]methanol |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CCC(CO)(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26FNO4S/c1-17-7-8-18(22)15-20(17)28(25,26)23-12-9-21(16-24,10-13-23)11-14-27-19-5-3-2-4-6-19/h2-8,15,24H,9-14,16H2,1H3 |
| InChIKey | PFIMXJCOGXHDCV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |