C14H21ClN2O3S2 — CID 135120506
[(4aS,8aS)-7-(5-chlorothiophen-2-yl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135120506) has the molecular formula C14H21ClN2O3S2 and a molecular weight of 364.92 g/mol. Its IUPAC name is [(4aS,8aS)-7-(5-chlorothiophen-2-yl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-7-(5-chlorothiophen-2-yl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135120506 |
| Molecular Formula | C14H21ClN2O3S2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [(4aS,8aS)-7-(5-chlorothiophen-2-yl)sulfonyl-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CN1CCC[C@]2(CO)CCN(S(=O)(=O)c3ccc(Cl)s3)C[C@@H]12 |
| InChI | InChI=1S/C14H21ClN2O3S2/c1-16-7-2-5-14(10-18)6-8-17(9-11(14)16)22(19,20)13-4-3-12(15)21-13/h3-4,11,18H,2,5-10H2,1H3/t11-,14-/m1/s1 |
| InChIKey | OMWYROLAYVWFTC-BXUZGUMPSA-N |
| XLogP | 1.87 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |