C11H15ClN2O3S2 — CID 114509445
(NE)-N-[1-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperidin-4-ylidene]hydroxylamine (PubChem CID 114509445) has the molecular formula C11H15ClN2O3S2 and a molecular weight of 322.84 g/mol. Its IUPAC name is (NE)-N-[1-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 114509445 |
| Molecular Formula | C11H15ClN2O3S2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (NE)-N-[1-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CCC1CN(S(=O)(=O)c2ccc(Cl)s2)CC/C1=N\O |
| InChI | InChI=1S/C11H15ClN2O3S2/c1-2-8-7-14(6-5-9(8)13-15)19(16,17)11-4-3-10(12)18-11/h3-4,8,15H,2,5-7H2,1H3/b13-9+ |
| InChIKey | NDCMUHWJQPNCHG-UKTHLTGXSA-N |
| XLogP | 2.65 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|