C17H23N3O3S — CID 135116859
3-[[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]sulfonyl]benzonitrile (PubChem CID 135116859) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 3-[[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]sulfonyl]benzonitrile.
| Compound Name | 3-[[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 135116859 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-[[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]sulfonyl]benzonitrile |
| SMILES | CN1CCC[C@]2(CO)CCN(S(=O)(=O)c3cccc(C#N)c3)C[C@@H]12 |
| InChI | InChI=1S/C17H23N3O3S/c1-19-8-3-6-17(13-21)7-9-20(12-16(17)19)24(22,23)15-5-2-4-14(10-15)11-18/h2,4-5,10,16,21H,3,6-9,12-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | LKGIYJILWBBWBN-IAGOWNOFSA-N |
| XLogP | 1.03 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |