C38H37ClN4 — CID 135121682
1-[1-[4-[3-(4-chlorophenyl)-2,5-diphenylpyrrol-1-yl]phenyl]ethyl]-4-hexyltriazole (PubChem CID 135121682) has the molecular formula C38H37ClN4 and a molecular weight of 585.20 g/mol. Its IUPAC name is 1-[1-[4-[3-(4-chlorophenyl)-2,5-diphenylpyrrol-1-yl]phenyl]ethyl]-4-hexyltriazole.
| Compound Name | 1-[1-[4-[3-(4-chlorophenyl)-2,5-diphenylpyrrol-1-yl]phenyl]ethyl]-4-hexyltriazole |
|---|---|
| PubChem CID | 135121682 |
| Molecular Formula | C38H37ClN4 |
| Molecular Weight | 585.20 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 1-[1-[4-[3-(4-chlorophenyl)-2,5-diphenylpyrrol-1-yl]phenyl]ethyl]-4-hexyltriazole |
| SMILES | CCCCCCc1cn(C(C)c2ccc(-n3c(-c4ccccc4)cc(-c4ccc(Cl)cc4)c3-c3ccccc3)cc2)nn1 |
| InChI | InChI=1S/C38H37ClN4/c1-3-4-5-12-17-34-27-42(41-40-34)28(2)29-20-24-35(25-21-29)43-37(31-13-8-6-9-14-31)26-36(30-18-22-33(39)23-19-30)38(43)32-15-10-7-11-16-32/h6-11,13-16,18-28H,3-5,12,17H2,1-2H3 |
| InChIKey | WKPFDSKLZLHBKL-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.20 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|