C43H40N4 — CID 135121690
4-(4-pentylphenyl)-1-[1-[4-(2,3,5-triphenylpyrrol-1-yl)phenyl]ethyl]triazole (PubChem CID 135121690) has the molecular formula C43H40N4 and a molecular weight of 612.82 g/mol. Its IUPAC name is 4-(4-pentylphenyl)-1-[1-[4-(2,3,5-triphenylpyrrol-1-yl)phenyl]ethyl]triazole.
| Compound Name | 4-(4-pentylphenyl)-1-[1-[4-(2,3,5-triphenylpyrrol-1-yl)phenyl]ethyl]triazole |
|---|---|
| PubChem CID | 135121690 |
| Molecular Formula | C43H40N4 |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | 4-(4-pentylphenyl)-1-[1-[4-(2,3,5-triphenylpyrrol-1-yl)phenyl]ethyl]triazole |
| SMILES | CCCCCc1ccc(-c2cn(C(C)c3ccc(-n4c(-c5ccccc5)cc(-c5ccccc5)c4-c4ccccc4)cc3)nn2)cc1 |
| InChI | InChI=1S/C43H40N4/c1-3-4-8-15-33-22-24-36(25-23-33)41-31-46(45-44-41)32(2)34-26-28-39(29-27-34)47-42(37-18-11-6-12-19-37)30-40(35-16-9-5-10-17-35)43(47)38-20-13-7-14-21-38/h5-7,9-14,16-32H,3-4,8,15H2,1-2H3 |
| InChIKey | SHURPRIHQBXGOM-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|