C13H26NO4+ — CID 135121813
[5-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl-trimethylazanium (PubChem CID 135121813) has the molecular formula C13H26NO4+ and a molecular weight of 260.35 g/mol. Its IUPAC name is [5-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl-trimethylazanium.
| Compound Name | [5-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 135121813 |
| Molecular Formula | C13H26NO4+ |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | [5-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl-trimethylazanium |
| SMILES | CC(=O)OCC1(C[N+](C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C13H26NO4/c1-11(15)16-8-13(7-14(4,5)6)9-17-12(2,3)18-10-13/h7-10H2,1-6H3/q+1 |
| InChIKey | DVDDLUZOVHMTTP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|