C16H30 — CID 135121997
6,6,7,7,8,8-hexamethyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene (PubChem CID 135121997) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 6,6,7,7,8,8-hexamethyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene.
| Compound Name | 6,6,7,7,8,8-hexamethyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 135121997 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 6,6,7,7,8,8-hexamethyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene |
| SMILES | CC1(C)CC2CCCCC2C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H30/c1-14(2)11-12-9-7-8-10-13(12)15(3,4)16(14,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | XUVLMQRCSBLMMO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |