C25H30ClNO2Sn — CID 135122102
3-[chloro(diethyl)stannyl]oxy-2-[N-(4-methylphenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one (PubChem CID 135122102) has the molecular formula C25H30ClNO2Sn and a molecular weight of 530.68 g/mol. Its IUPAC name is 3-[chloro(diethyl)stannyl]oxy-2-[N-(4-methylphenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one.
| Compound Name | 3-[chloro(diethyl)stannyl]oxy-2-[N-(4-methylphenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one |
|---|---|
| PubChem CID | 135122102 |
| Molecular Formula | C25H30ClNO2Sn |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 3-[chloro(diethyl)stannyl]oxy-2-[N-(4-methylphenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one |
| SMILES | CC[Sn](Cl)(CC)OC1=C(/C(CC(C)C)=N\c2ccc(C)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H21NO2.2C2H5.ClH.Sn/c1-13(2)12-18(22-15-10-8-14(3)9-11-15)19-20(23)16-6-4-5-7-17(16)21(19)24;2*1-2;;/h4-11,13,23H,12H2,1-3H3;2*1H2,2H3;1H;/q;;;;+2/p-2/b22-18-;;;; |
| InChIKey | HUSRMOIDEDIFQI-BLJMMOSVSA-L |
| XLogP | 7.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|