C24H27Cl2NO2Sn — CID 135122103
3-[chloro(diethyl)stannyl]oxy-2-[N-(4-chlorophenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one (PubChem CID 135122103) has the molecular formula C24H27Cl2NO2Sn and a molecular weight of 551.10 g/mol. Its IUPAC name is 3-[chloro(diethyl)stannyl]oxy-2-[N-(4-chlorophenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one.
| Compound Name | 3-[chloro(diethyl)stannyl]oxy-2-[N-(4-chlorophenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one |
|---|---|
| PubChem CID | 135122103 |
| Molecular Formula | C24H27Cl2NO2Sn |
| Molecular Weight | 551.10 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 3-[chloro(diethyl)stannyl]oxy-2-[N-(4-chlorophenyl)-C-(2-methylpropyl)carbonimidoyl]inden-1-one |
| SMILES | CC[Sn](Cl)(CC)OC1=C(/C(CC(C)C)=N\c2ccc(Cl)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H18ClNO2.2C2H5.ClH.Sn/c1-12(2)11-17(22-14-9-7-13(21)8-10-14)18-19(23)15-5-3-4-6-16(15)20(18)24;2*1-2;;/h3-10,12,23H,11H2,1-2H3;2*1H2,2H3;1H;/q;;;;+2/p-2/b22-17-;;;; |
| InChIKey | GPUUJZBLONSTPC-SUVQGYCISA-L |
| XLogP | 7.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.10 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|