C21H21F2N3O4S — CID 135125724
5-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 135125724) has the molecular formula C21H21F2N3O4S and a molecular weight of 449.48 g/mol. Its IUPAC name is 5-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | 5-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135125724 |
| Molecular Formula | C21H21F2N3O4S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=NC(C)(c2cc(C=C(F)c3ccc4c(c3)OCCO4)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C21H21F2N3O4S/c1-21(12-31(27,28)26(2)20(24)25-21)15-9-13(3-5-16(15)22)10-17(23)14-4-6-18-19(11-14)30-8-7-29-18/h3-6,9-11H,7-8,12H2,1-2H3,(H2,24,25) |
| InChIKey | MTRWBNJJZRXCMU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|