C21H22F2N4O3S — CID 135125928
(5R)-5-[5-[(Z)-2-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 135125928) has the molecular formula C21H22F2N4O3S and a molecular weight of 448.50 g/mol. Its IUPAC name is (5R)-5-[5-[(Z)-2-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[5-[(Z)-2-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135125928 |
| Molecular Formula | C21H22F2N4O3S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (5R)-5-[5-[(Z)-2-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3cc4c(cn3)OCCC4)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C21H22F2N4O3S/c1-21(12-31(28,29)27(2)20(24)26-21)15-8-13(5-6-16(15)22)9-17(23)18-10-14-4-3-7-30-19(14)11-25-18/h5-6,8-11H,3-4,7,12H2,1-2H3,(H2,24,26)/b17-9-/t21-/m0/s1 |
| InChIKey | RWGILFQBVCWEPP-YWUCYRDRSA-N |
| XLogP | 2.82 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |