C20H18Cl2N4O — CID 135125815
N-[1-(2,5-dichloro-4-pyridinyl)azetidin-3-yl]-2,4-dimethylquinoline-6-carboxamide (PubChem CID 135125815) has the molecular formula C20H18Cl2N4O and a molecular weight of 401.30 g/mol. Its IUPAC name is N-[1-(2,5-dichloro-4-pyridinyl)azetidin-3-yl]-2,4-dimethylquinoline-6-carboxamide.
| Compound Name | N-[1-(2,5-dichloro-4-pyridinyl)azetidin-3-yl]-2,4-dimethylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 135125815 |
| Molecular Formula | C20H18Cl2N4O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[1-(2,5-dichloro-4-pyridinyl)azetidin-3-yl]-2,4-dimethylquinoline-6-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)NC3CN(c4cc(Cl)ncc4Cl)C3)ccc2n1 |
| InChI | InChI=1S/C20H18Cl2N4O/c1-11-5-12(2)24-17-4-3-13(6-15(11)17)20(27)25-14-9-26(10-14)18-7-19(22)23-8-16(18)21/h3-8,14H,9-10H2,1-2H3,(H,25,27) |
| InChIKey | OJPCUCSFJQSOPQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|