C26H37NO3 — CID 135127429
N-[5-[hydroxy(phenyl)methoxy]-2,2,6,6-tetramethylheptan-3-yl]-N-methylbenzamide (PubChem CID 135127429) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[5-[hydroxy(phenyl)methoxy]-2,2,6,6-tetramethylheptan-3-yl]-N-methylbenzamide.
| Compound Name | N-[5-[hydroxy(phenyl)methoxy]-2,2,6,6-tetramethylheptan-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 135127429 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | N-[5-[hydroxy(phenyl)methoxy]-2,2,6,6-tetramethylheptan-3-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)C(CC(OC(O)c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H37NO3/c1-25(2,3)21(27(7)23(28)19-14-10-8-11-15-19)18-22(26(4,5)6)30-24(29)20-16-12-9-13-17-20/h8-17,21-22,24,29H,18H2,1-7H3 |
| InChIKey | ABRHSTZTOFRJNQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|