C27H30F4N4O — CID 135129019
6-[4-(3-fluorophenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]-1-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 135129019) has the molecular formula C27H30F4N4O and a molecular weight of 502.56 g/mol. Its IUPAC name is 6-[4-(3-fluorophenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]-1-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 6-[4-(3-fluorophenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]-1-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 135129019 |
| Molecular Formula | C27H30F4N4O |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 6-[4-(3-fluorophenoxy)-6-(trifluoromethyl)pyrimidin-2-yl]-1-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CC1C=C(CN2CCCC3CN(c4nc(Oc5cccc(F)c5)cc(C(F)(F)F)n4)CCC32)C=CC1 |
| InChI | InChI=1S/C27H30F4N4O/c1-18-5-2-6-19(13-18)16-34-11-4-7-20-17-35(12-10-23(20)34)26-32-24(27(29,30)31)15-25(33-26)36-22-9-3-8-21(28)14-22/h2-3,6,8-9,13-15,18,20,23H,4-5,7,10-12,16-17H2,1H3 |
| InChIKey | NWQMYIQUQBNMDX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |