About 3-(3,3-diaminoprop-1-en-2-ylamino)butanal
3-(3,3-diaminoprop-1-en-2-ylamino)butanal (PubChem CID 135130114) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 3-(3,3-diaminoprop-1-en-2-ylamino)butanal.
Molecular Properties
| Compound Name | 3-(3,3-diaminoprop-1-en-2-ylamino)butanal |
| PubChem CID | 135130114 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 3-(3,3-diaminoprop-1-en-2-ylamino)butanal |
| SMILES | C=C(NC(C)CC=O)C(N)N |
| InChI | InChI=1S/C7H15N3O/c1-5(3-4-11)10-6(2)7(8)9/h4-5,7,10H,2-3,8-9H2,1H3 |
| InChIKey | QUUXGYJZTOAKHV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-diaminoprop-1-en-2-ylamino)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-diaminoprop-1-en-2-ylamino)butanal?
The IUPAC name of 3-(3,3-diaminoprop-1-en-2-ylamino)butanal (CID 135130114) is 3-(3,3-diaminoprop-1-en-2-ylamino)butanal.
What is the SMILES notation for 3-(3,3-diaminoprop-1-en-2-ylamino)butanal?
The canonical SMILES for 3-(3,3-diaminoprop-1-en-2-ylamino)butanal is C=C(NC(C)CC=O)C(N)N.
What is the InChIKey of 3-(3,3-diaminoprop-1-en-2-ylamino)butanal?
The InChIKey is QUUXGYJZTOAKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-5(3-4-11)10-6(2)7(8)9/h4-5,7,10H,2-3,8-9H2,1H3.
What are the key properties of 3-(3,3-diaminoprop-1-en-2-ylamino)butanal?
3-(3,3-diaminoprop-1-en-2-ylamino)butanal has a molecular weight of 157.22 g/mol, XLogP of -0.69, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-diaminoprop-1-en-2-ylamino)butanal is sourced from PubChem (CID 135130114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).