C6H14ClNO3 — CID 54600176
3-amino-4,5-dihydroxyhexanal;hydrochloride (PubChem CID 54600176) has the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. Its IUPAC name is 3-amino-4,5-dihydroxyhexanal;hydrochloride.
| Compound Name | 3-amino-4,5-dihydroxyhexanal;hydrochloride |
|---|---|
| PubChem CID | 54600176 |
| Molecular Formula | C6H14ClNO3 |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 3-amino-4,5-dihydroxyhexanal;hydrochloride |
| SMILES | CC(O)C(O)C(N)CC=O.Cl |
| InChI | InChI=1S/C6H13NO3.ClH/c1-4(9)6(10)5(7)2-3-8;/h3-6,9-10H,2,7H2,1H3;1H |
| InChIKey | FHYCNFQONIRRCV-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.63 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|