C56H39N7 — CID 135131110
5-(2,6-diphenylpyrimidin-4-yl)-1-N,1-N,3-N,3-N-tetraphenyl-2-(3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)benzene-1,3-diamine (PubChem CID 135131110) has the molecular formula C56H39N7 and a molecular weight of 809.98 g/mol. Its IUPAC name is 5-(2,6-diphenylpyrimidin-4-yl)-1-N,1-N,3-N,3-N-tetraphenyl-2-(3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)benzene-1,3-diamine.
| Compound Name | 5-(2,6-diphenylpyrimidin-4-yl)-1-N,1-N,3-N,3-N-tetraphenyl-2-(3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 135131110 |
| Molecular Formula | C56H39N7 |
| Molecular Weight | 809.98 g/mol |
| Exact Mass | 809.33 |
| IUPAC Name | 5-(2,6-diphenylpyrimidin-4-yl)-1-N,1-N,3-N,3-N-tetraphenyl-2-(3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)benzene-1,3-diamine |
| SMILES | c1ccc(-c2cc(-c3cc(N(c4ccccc4)c4ccccc4)c(-n4c5cccnc5c5ncccc54)c(N(c4ccccc4)c4ccccc4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C56H39N7/c1-7-21-40(22-8-1)47-39-48(60-56(59-47)41-23-9-2-10-24-41)42-37-51(61(43-25-11-3-12-26-43)44-27-13-4-14-28-44)55(63-49-33-19-35-57-53(49)54-50(63)34-20-36-58-54)52(38-42)62(45-29-15-5-16-30-45)46-31-17-6-18-32-46/h1-39H |
| InChIKey | HYVJYKIOSUNJMM-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.98 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |