C27H24N4O2 — CID 135131941
(6aR,7R,10aS)-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131941) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131941 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (6aR,7R,10aS)-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c3c(n2)[C@]2(C)C=C(C#N)C(=O)[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C27H24N4O2/c1-16-21-10-9-20-23(17-7-5-4-6-8-17)30-26(18-11-12-29-22(13-18)33-3)31-25(20)27(21,2)14-19(15-28)24(16)32/h4-8,11-14,16,21H,9-10H2,1-3H3/t16-,21-,27-/m1/s1 |
| InChIKey | HAEVIZXUUPKSJU-YIPKYWMUSA-N |
| XLogP | 4.70 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |