C26H28FN5O — CID 135132057
(6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135132057) has the molecular formula C26H28FN5O and a molecular weight of 445.54 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135132057 |
| Molecular Formula | C26H28FN5O |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(N4CCN(C)CC4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C26H28FN5O/c1-16-20-9-8-19-22(18-6-4-5-7-21(18)27)29-25(32-12-10-31(3)11-13-32)30-24(19)26(20,2)14-17(15-28)23(16)33/h4-7,14,16,20H,8-13H2,1-3H3/t16-,20-,26-/m1/s1 |
| InChIKey | NWHWDHYNFFLIQL-KVYOAWSJSA-N |
| XLogP | 3.52 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |