C15H9F4N3O — CID 135132187
1-[1-(8-fluoroquinolin-4-yl)-5-(trifluoromethyl)pyrazol-4-yl]ethanone (PubChem CID 135132187) has the molecular formula C15H9F4N3O and a molecular weight of 323.25 g/mol. Its IUPAC name is 1-[1-(8-fluoroquinolin-4-yl)-5-(trifluoromethyl)pyrazol-4-yl]ethanone.
| Compound Name | 1-[1-(8-fluoroquinolin-4-yl)-5-(trifluoromethyl)pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 135132187 |
| Molecular Formula | C15H9F4N3O |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-[1-(8-fluoroquinolin-4-yl)-5-(trifluoromethyl)pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1cnn(-c2ccnc3c(F)cccc23)c1C(F)(F)F |
| InChI | InChI=1S/C15H9F4N3O/c1-8(23)10-7-21-22(14(10)15(17,18)19)12-5-6-20-13-9(12)3-2-4-11(13)16/h2-7H,1H3 |
| InChIKey | MXAFEAVCOLNJRX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |