C10H9ClN2O3 — CID 135132416
(E)-4-(3-amino-5-chloroanilino)-4-oxobut-2-enoic acid (PubChem CID 135132416) has the molecular formula C10H9ClN2O3 and a molecular weight of 240.65 g/mol. Its IUPAC name is (E)-4-(3-amino-5-chloroanilino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(3-amino-5-chloroanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 135132416 |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (E)-4-(3-amino-5-chloroanilino)-4-oxobut-2-enoic acid |
| SMILES | Nc1cc(Cl)cc(NC(=O)/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C10H9ClN2O3/c11-6-3-7(12)5-8(4-6)13-9(14)1-2-10(15)16/h1-5H,12H2,(H,13,14)(H,15,16)/b2-1+ |
| InChIKey | WRUSTFXAUZZBNR-OWOJBTEDSA-N |
| XLogP | 1.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|