C34H23F3N4O6 — CID 135132741
2-(4-methyl-2-nitrophenyl)-1,4-bis(4-methylphenyl)-5-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 135132741) has the molecular formula C34H23F3N4O6 and a molecular weight of 640.57 g/mol. Its IUPAC name is 2-(4-methyl-2-nitrophenyl)-1,4-bis(4-methylphenyl)-5-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2-(4-methyl-2-nitrophenyl)-1,4-bis(4-methylphenyl)-5-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 135132741 |
| Molecular Formula | C34H23F3N4O6 |
| Molecular Weight | 640.57 g/mol |
| Exact Mass | 640.16 |
| IUPAC Name | 2-(4-methyl-2-nitrophenyl)-1,4-bis(4-methylphenyl)-5-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | Cc1ccc(C2=C3C(=O)N(c4ccc(C(F)(F)F)cc4[N+](=O)[O-])C(c4ccc(C)cc4)=C3C(=O)N2c2ccc(C)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H23F3N4O6/c1-18-4-9-21(10-5-18)30-28-29(32(42)38(30)24-14-8-20(3)16-26(24)40(44)45)31(22-11-6-19(2)7-12-22)39(33(28)43)25-15-13-23(34(35,36)37)17-27(25)41(46)47/h4-17H,1-3H3 |
| InChIKey | SIEYHNKKKOFTJX-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.57 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|