C11H7F3N2O4 — CID 14324454
5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]-1,2-oxazol-3-one (PubChem CID 14324454) has the molecular formula C11H7F3N2O4 and a molecular weight of 288.18 g/mol. Its IUPAC name is 5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]-1,2-oxazol-3-one.
| Compound Name | 5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 14324454 |
| Molecular Formula | C11H7F3N2O4 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]-1,2-oxazol-3-one |
| SMILES | Cc1cc(=O)n(-c2ccc(C(F)(F)F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H7F3N2O4/c1-6-4-10(17)15(20-6)8-3-2-7(11(12,13)14)5-9(8)16(18)19/h2-5H,1H3 |
| InChIKey | FUXBLGBZRTYSTA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|