C28H32F3N3O2 — CID 135134008
(E)-3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid (PubChem CID 135134008) has the molecular formula C28H32F3N3O2 and a molecular weight of 499.58 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135134008 |
| Molecular Formula | C28H32F3N3O2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid |
| SMILES | C[C@@H]1Cc2cc(-c3cnn(C)c3)ccc2[C@@H](C2(C)C(F)=CC(/C=C/C(=O)O)=CC2F)N1CC(C)(C)F |
| InChI | InChI=1S/C28H32F3N3O2/c1-17-10-20-13-19(21-14-32-33(5)15-21)7-8-22(20)26(34(17)16-27(2,3)31)28(4)23(29)11-18(12-24(28)30)6-9-25(35)36/h6-9,11-15,17,23,26H,10,16H2,1-5H3,(H,35,36)/b9-6+/t17-,23?,26+,28?/m1/s1 |
| InChIKey | NUBNTBNGMBDDHW-LALSSVPDSA-N |
| XLogP | 5.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|