C30H29N3O3 — CID 135363954
(E)-3-[4-[(1S,3S)-2-(4-methoxyphenyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 135363954) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is (E)-3-[4-[(1S,3S)-2-(4-methoxyphenyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1S,3S)-2-(4-methoxyphenyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135363954 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (E)-3-[4-[(1S,3S)-2-(4-methoxyphenyl)-3-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(N2[C@@H](c3ccc(/C=C/C(=O)O)cc3)c3ccc(-c4cnn(C)c4)cc3C[C@@H]2C)cc1 |
| InChI | InChI=1S/C30H29N3O3/c1-20-16-24-17-23(25-18-31-32(2)19-25)9-14-28(24)30(33(20)26-10-12-27(36-3)13-11-26)22-7-4-21(5-8-22)6-15-29(34)35/h4-15,17-20,30H,16H2,1-3H3,(H,34,35)/b15-6+/t20-,30-/m0/s1 |
| InChIKey | KCLCZHWSBDKATG-BBMJSSMLSA-N |
| XLogP | 5.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|