C32H35N3O2 — CID 145337348
methanol;(E)-3-[4-[3-methyl-2-(4-propan-2-ylphenyl)-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enal (PubChem CID 145337348) has the molecular formula C32H35N3O2 and a molecular weight of 493.65 g/mol. Its IUPAC name is methanol;(E)-3-[4-[3-methyl-2-(4-propan-2-ylphenyl)-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enal.
| Compound Name | methanol;(E)-3-[4-[3-methyl-2-(4-propan-2-ylphenyl)-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 145337348 |
| Molecular Formula | C32H35N3O2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | methanol;(E)-3-[4-[3-methyl-2-(4-propan-2-ylphenyl)-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enal |
| SMILES | CC(C)c1ccc(N2C(C)Cc3cc(-c4cn[nH]c4)ccc3C2c2ccc(/C=C/C=O)cc2)cc1.CO |
| InChI | InChI=1S/C31H31N3O.CH4O/c1-21(2)24-10-13-29(14-11-24)34-22(3)17-27-18-26(28-19-32-33-20-28)12-15-30(27)31(34)25-8-6-23(7-9-25)5-4-16-35;1-2/h4-16,18-22,31H,17H2,1-3H3,(H,32,33);2H,1H3/b5-4+; |
| InChIKey | NNUACYSFXQVVHV-FXRZFVDSSA-N |
| XLogP | 6.56 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|