About 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine
2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine (PubChem CID 135135279) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine |
| PubChem CID | 135135279 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine |
| SMILES | CC1=C(CC2CCNC2)NC(C)C=N1 |
| InChI | InChI=1S/C11H19N3/c1-8-6-13-9(2)11(14-8)5-10-3-4-12-7-10/h6,8,10,12,14H,3-5,7H2,1-2H3 |
| InChIKey | VPSMKDWDOGIAQI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine?
The IUPAC name of 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine (CID 135135279) is 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine.
What is the SMILES notation for 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine?
The canonical SMILES for 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine is CC1=C(CC2CCNC2)NC(C)C=N1.
What is the InChIKey of 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine?
The InChIKey is VPSMKDWDOGIAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-8-6-13-9(2)11(14-8)5-10-3-4-12-7-10/h6,8,10,12,14H,3-5,7H2,1-2H3.
What are the key properties of 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine?
2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine has a molecular weight of 193.29 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyrazine is sourced from PubChem (CID 135135279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).