C21H32N2O3 — CID 135136082
ethyl 2-[[(2S,4S)-2-(3,3-dimethylbutoxy)-4-phenylpentylidene]amino]-2-iminoacetate (PubChem CID 135136082) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is ethyl 2-[[(2S,4S)-2-(3,3-dimethylbutoxy)-4-phenylpentylidene]amino]-2-iminoacetate.
| Compound Name | ethyl 2-[[(2S,4S)-2-(3,3-dimethylbutoxy)-4-phenylpentylidene]amino]-2-iminoacetate |
|---|---|
| PubChem CID | 135136082 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | ethyl 2-[[(2S,4S)-2-(3,3-dimethylbutoxy)-4-phenylpentylidene]amino]-2-iminoacetate |
| SMILES | [H]/N=C(/N=C/[C@H](C[C@H](C)c1ccccc1)OCCC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C21H32N2O3/c1-6-25-20(24)19(22)23-15-18(26-13-12-21(3,4)5)14-16(2)17-10-8-7-9-11-17/h7-11,15-16,18,22H,6,12-14H2,1-5H3/b22-19+,23-15+/t16-,18-/m0/s1 |
| InChIKey | BMEDHZQQNNRIMF-NZCBAFLUSA-N |
| XLogP | 4.61 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|