About N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide
N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide (PubChem CID 135136349) has the molecular formula C17H15ClN2O4S
and a molecular weight of 378.84 g/mol. Its IUPAC name is N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide.
Molecular Properties
| Compound Name | N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide |
| PubChem CID | 135136349 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(=O)N(C=O)CC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-19(9-12-5-3-2-4-6-12)16(23)17(24)20(11-21)10-13(22)14-7-8-15(18)25-14/h2-8,11H,9-10H2,1H3 |
| InChIKey | JPGBFGVWEGNQIW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide?
The IUPAC name of N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide (CID 135136349) is N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide.
What is the SMILES notation for N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide?
The canonical SMILES for N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide is CN(Cc1ccccc1)C(=O)C(=O)N(C=O)CC(=O)c1ccc(Cl)s1.
What is the InChIKey of N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide?
The InChIKey is JPGBFGVWEGNQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O4S/c1-19(9-12-5-3-2-4-6-12)16(23)17(24)20(11-21)10-13(22)14-7-8-15(18)25-14/h2-8,11H,9-10H2,1H3.
What are the key properties of N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide?
N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide has a molecular weight of 378.84 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-N'-formyl-N-methyloxamide is sourced from PubChem (CID 135136349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).