C45H41NO4 — CID 135137356
1-[2-(4-ethenylphenyl)ethyl]-4-[3-[8-[2-(4-ethenylphenyl)ethyl]-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 135137356) has the molecular formula C45H41NO4 and a molecular weight of 659.83 g/mol. Its IUPAC name is 1-[2-(4-ethenylphenyl)ethyl]-4-[3-[8-[2-(4-ethenylphenyl)ethyl]-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1-[2-(4-ethenylphenyl)ethyl]-4-[3-[8-[2-(4-ethenylphenyl)ethyl]-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 135137356 |
| Molecular Formula | C45H41NO4 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | 1-[2-(4-ethenylphenyl)ethyl]-4-[3-[8-[2-(4-ethenylphenyl)ethyl]-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=Cc1ccc(CCC2=CC3CC2C2C(=O)C(c4cccc(N5C(=O)C6C7C=CC(CCc8ccc(C=C)cc8)(C7)C6C5=O)c4)C(=O)C32)cc1 |
| InChI | InChI=1S/C45H41NO4/c1-3-26-8-12-28(13-9-26)16-17-30-22-33-24-35(30)39-36(33)41(47)38(42(39)48)31-6-5-7-34(23-31)46-43(49)37-32-19-21-45(25-32,40(37)44(46)50)20-18-29-14-10-27(4-2)11-15-29/h3-15,19,21-23,32-33,35-40H,1-2,16-18,20,24-25H2 |
| InChIKey | LEXIPFSYBKXOKO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|