C23H21N5O — CID 135138660
2-[3-(2-aminophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 135138660) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-[3-(2-aminophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 2-[3-(2-aminophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 135138660 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[3-(2-aminophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | Nc1ccccc1-c1cc(-c2ccccc2C(=O)NCCc2ccccn2)[nH]n1 |
| InChI | InChI=1S/C23H21N5O/c24-20-11-4-3-10-19(20)22-15-21(27-28-22)17-8-1-2-9-18(17)23(29)26-14-12-16-7-5-6-13-25-16/h1-11,13,15H,12,14,24H2,(H,26,29)(H,27,28) |
| InChIKey | VWVAQCYIIRNIFH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|