C23H19ClN4O — CID 134462934
2-[3-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 134462934) has the molecular formula C23H19ClN4O and a molecular weight of 402.89 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 2-[3-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 134462934 |
| Molecular Formula | C23H19ClN4O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1ccccn1)c1ccccc1-c1cc(-c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C23H19ClN4O/c24-17-7-5-6-16(14-17)21-15-22(28-27-21)19-9-1-2-10-20(19)23(29)26-13-11-18-8-3-4-12-25-18/h1-10,12,14-15H,11,13H2,(H,26,29)(H,27,28) |
| InChIKey | GWRNEWTUKPZHRE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |