C19H19ClN4O — CID 46104817
5-(3-chlorophenyl)-1-ethyl-N-(2-pyridin-2-ylethyl)pyrazole-3-carboxamide (PubChem CID 46104817) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-1-ethyl-N-(2-pyridin-2-ylethyl)pyrazole-3-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-1-ethyl-N-(2-pyridin-2-ylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46104817 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-(3-chlorophenyl)-1-ethyl-N-(2-pyridin-2-ylethyl)pyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)NCCc2ccccn2)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN4O/c1-2-24-18(14-6-5-7-15(20)12-14)13-17(23-24)19(25)22-11-9-16-8-3-4-10-21-16/h3-8,10,12-13H,2,9,11H2,1H3,(H,22,25) |
| InChIKey | DESIAKYHPSUCNZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |