C29H39N4O3+ — CID 135139059
5-[2-[[4-[[3-(1-azoniabicyclo[2.2.2]octan-1-yl)-1-hydroxypropyl]amino]-3-methylphenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 135139059) has the molecular formula C29H39N4O3+ and a molecular weight of 491.66 g/mol. Its IUPAC name is 5-[2-[[4-[[3-(1-azoniabicyclo[2.2.2]octan-1-yl)-1-hydroxypropyl]amino]-3-methylphenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-[[4-[[3-(1-azoniabicyclo[2.2.2]octan-1-yl)-1-hydroxypropyl]amino]-3-methylphenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135139059 |
| Molecular Formula | C29H39N4O3+ |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 5-[2-[[4-[[3-(1-azoniabicyclo[2.2.2]octan-1-yl)-1-hydroxypropyl]amino]-3-methylphenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | Cc1cc(CNCCc2ccc(O)c3[nH]c(=O)ccc23)ccc1NC(O)CC[N+]12CCC(CC1)CC2 |
| InChI | InChI=1S/C29H38N4O3/c1-20-18-22(19-30-13-8-23-3-6-26(34)29-24(23)4-7-27(35)32-29)2-5-25(20)31-28(36)12-17-33-14-9-21(10-15-33)11-16-33/h2-7,18,21,28,30-31,36H,8-17,19H2,1H3,(H-,32,34,35)/p+1 |
| InChIKey | GTFJACNBNQFLSX-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|