C16H19IN4O3S — CID 135139408
methyl 1-iodosulfanyl-4-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]pyrrole-2-carboxylate (PubChem CID 135139408) has the molecular formula C16H19IN4O3S and a molecular weight of 474.32 g/mol. Its IUPAC name is methyl 1-iodosulfanyl-4-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-iodosulfanyl-4-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135139408 |
| Molecular Formula | C16H19IN4O3S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | methyl 1-iodosulfanyl-4-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2nc(NC3CCOCC3)ncc2C)cn1SI |
| InChI | InChI=1S/C16H19IN4O3S/c1-10-8-18-16(19-12-3-5-24-6-4-12)20-14(10)11-7-13(15(22)23-2)21(9-11)25-17/h7-9,12H,3-6H2,1-2H3,(H,18,19,20) |
| InChIKey | KMYUYGACELAYFW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|