C10H6Cl2IN3O2S — CID 178056985
methyl 4-(2,5-dichloropyrimidin-4-yl)-1-iodosulfanylpyrrole-2-carboxylate (PubChem CID 178056985) has the molecular formula C10H6Cl2IN3O2S and a molecular weight of 430.05 g/mol. Its IUPAC name is methyl 4-(2,5-dichloropyrimidin-4-yl)-1-iodosulfanylpyrrole-2-carboxylate.
| Compound Name | methyl 4-(2,5-dichloropyrimidin-4-yl)-1-iodosulfanylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 178056985 |
| Molecular Formula | C10H6Cl2IN3O2S |
| Molecular Weight | 430.05 g/mol |
| Exact Mass | 428.86 |
| IUPAC Name | methyl 4-(2,5-dichloropyrimidin-4-yl)-1-iodosulfanylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2nc(Cl)ncc2Cl)cn1SI |
| InChI | InChI=1S/C10H6Cl2IN3O2S/c1-18-9(17)7-2-5(4-16(7)19-13)8-6(11)3-14-10(12)15-8/h2-4H,1H3 |
| InChIKey | VTAVEVLIRZUXQU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.05 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|