About CID 169205887
CID 169205887 (PubChem CID 169205887) has the molecular formula C14H14BClIN3O2S
and a molecular weight of 461.52 g/mol.
Molecular Properties
| Compound Name | CID 169205887 |
| PubChem CID | 169205887 |
| Molecular Formula | C14H14BClIN3O2S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)Nc1cc(-c2cc(C(=O)OC)n(SI)c2)c(Cl)cn1 |
| InChI | InChI=1S/C14H14BClIN3O2S/c1-14(2,15)19-12-5-9(10(16)6-18-12)8-4-11(13(21)22-3)20(7-8)23-17/h4-7H,1-3H3,(H,18,19) |
| InChIKey | YBKNSMWXNQDOGH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 169205887 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169205887?
The IUPAC name of CID 169205887 (CID 169205887) is not available.
What is the SMILES notation for CID 169205887?
The canonical SMILES for CID 169205887 is [B]C(C)(C)Nc1cc(-c2cc(C(=O)OC)n(SI)c2)c(Cl)cn1.
What is the InChIKey of CID 169205887?
The InChIKey is YBKNSMWXNQDOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BClIN3O2S/c1-14(2,15)19-12-5-9(10(16)6-18-12)8-4-11(13(21)22-3)20(7-8)23-17/h4-7H,1-3H3,(H,18,19).
What are the key properties of CID 169205887?
CID 169205887 has a molecular weight of 461.52 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169205887 is sourced from PubChem (CID 169205887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).