C21H22ClN3O4S — CID 176610453
methyl 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate (PubChem CID 176610453) has the molecular formula C21H22ClN3O4S and a molecular weight of 454.99 g/mol. Its IUPAC name is methyl 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 176610453 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | methyl 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-1-(4-methylphenyl)sulfonylpyrrole-2-carboxylate |
| SMILES | [2H]C([2H])([2H])C([2H])(Nc1cc(-c2cc(C(=O)OC)n(S(=O)(=O)c3ccc(C)cc3)c2)c(Cl)cn1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C21H22ClN3O4S/c1-13(2)24-20-10-17(18(22)11-23-20)15-9-19(21(26)29-4)25(12-15)30(27,28)16-7-5-14(3)6-8-16/h5-13H,1-4H3,(H,23,24)/i1D3,2D3,13D |
| InChIKey | VZYVEPCGYYFESE-GYDXGMDDSA-N |
| XLogP | 4.36 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |