C18H16INO3S — CID 141137039
2-iodo-4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrole (PubChem CID 141137039) has the molecular formula C18H16INO3S and a molecular weight of 453.30 g/mol. Its IUPAC name is 2-iodo-4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrole.
| Compound Name | 2-iodo-4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 141137039 |
| Molecular Formula | C18H16INO3S |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 2-iodo-4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrole |
| SMILES | COc1ccccc1-c1cc(I)n(S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H16INO3S/c1-13-7-9-15(10-8-13)24(21,22)20-12-14(11-18(20)19)16-5-3-4-6-17(16)23-2/h3-12H,1-2H3 |
| InChIKey | QPILLOZIOLQJDZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|