C27H26N2O6S — CID 11260671
4-[1-(4-methylphenyl)sulfonyl-5-(3,4,5-trimethoxyphenyl)pyrrol-3-yl]benzamide (PubChem CID 11260671) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is 4-[1-(4-methylphenyl)sulfonyl-5-(3,4,5-trimethoxyphenyl)pyrrol-3-yl]benzamide.
| Compound Name | 4-[1-(4-methylphenyl)sulfonyl-5-(3,4,5-trimethoxyphenyl)pyrrol-3-yl]benzamide |
|---|---|
| PubChem CID | 11260671 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 4-[1-(4-methylphenyl)sulfonyl-5-(3,4,5-trimethoxyphenyl)pyrrol-3-yl]benzamide |
| SMILES | COc1cc(-c2cc(-c3ccc(C(N)=O)cc3)cn2S(=O)(=O)c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26N2O6S/c1-17-5-11-22(12-6-17)36(31,32)29-16-21(18-7-9-19(10-8-18)27(28)30)13-23(29)20-14-24(33-2)26(35-4)25(15-20)34-3/h5-16H,1-4H3,(H2,28,30) |
| InChIKey | STHNYASNPNANSA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |