C23H22N3O5+ — CID 77189155
4-[7-hydroxy-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl]benzamide (PubChem CID 77189155) has the molecular formula C23H22N3O5+ and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-[7-hydroxy-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl]benzamide.
| Compound Name | 4-[7-hydroxy-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl]benzamide |
|---|---|
| PubChem CID | 77189155 |
| Molecular Formula | C23H22N3O5+ |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[7-hydroxy-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl]benzamide |
| SMILES | COc1cc(-c2cc3c(-c4ccc(C(N)=O)cc4)c[nH]c3[n+](O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O5/c1-29-19-9-15(10-20(30-2)21(19)31-3)16-8-17-18(11-25-23(17)26(28)12-16)13-4-6-14(7-5-13)22(24)27/h4-12,28H,1-3H3,(H2,24,27)/p+1 |
| InChIKey | HHBAYPCXATXKFD-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|